C31H51F3O2Si — CID 58808029
5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,1,1-trifluorohexan-2-one (PubChem CID 58808029) has the molecular formula C31H51F3O2Si and a molecular weight of 540.83 g/mol. Its IUPAC name is 5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,1,1-trifluorohexan-2-one.
| Compound Name | 5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,1,1-trifluorohexan-2-one |
|---|---|
| PubChem CID | 58808029 |
| Molecular Formula | C31H51F3O2Si |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.36 |
| IUPAC Name | 5-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,1,1-trifluorohexan-2-one |
| SMILES | CC(CCC(=O)C(F)(F)F)C1CCC2C3CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C31H51F3O2Si/c1-20(9-14-27(35)31(32,33)34)24-12-13-25-23-11-10-21-19-22(36-37(7,8)28(2,3)4)15-17-29(21,5)26(23)16-18-30(24,25)6/h10,20,22-26H,9,11-19H2,1-8H3/t20?,22-,23?,24?,25?,26?,29?,30?/m0/s1 |
| InChIKey | UKBKMBJWEJURSD-PASKOPACSA-N |
| XLogP | 9.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|