C10H13FN2 — CID 58808079
6-fluoro-2-methyl-1,2,3,4-tetrahydroquinolin-8-amine (PubChem CID 58808079) has the molecular formula C10H13FN2 and a molecular weight of 180.23 g/mol. Its IUPAC name is 6-fluoro-2-methyl-1,2,3,4-tetrahydroquinolin-8-amine.
| Compound Name | 6-fluoro-2-methyl-1,2,3,4-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 58808079 |
| Molecular Formula | C10H13FN2 |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 6-fluoro-2-methyl-1,2,3,4-tetrahydroquinolin-8-amine |
| SMILES | CC1CCc2cc(F)cc(N)c2N1 |
| InChI | InChI=1S/C10H13FN2/c1-6-2-3-7-4-8(11)5-9(12)10(7)13-6/h4-6,13H,2-3,12H2,1H3 |
| InChIKey | QGVIEVCWCHALSX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|