About 2,5-difluorobenzoyl chloride
2,5-difluorobenzoyl chloride (PubChem CID 588082) has the molecular formula C7H3ClF2O
and a molecular weight of 176.55 g/mol. Its IUPAC name is 2,5-difluorobenzoyl chloride.
Molecular Properties
| Compound Name | 2,5-difluorobenzoyl chloride |
| PubChem CID | 588082 |
| Molecular Formula | C7H3ClF2O |
| Molecular Weight | 176.55 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | 2,5-difluorobenzoyl chloride |
| SMILES | O=C(Cl)c1cc(F)ccc1F |
| InChI | InChI=1S/C7H3ClF2O/c8-7(11)5-3-4(9)1-2-6(5)10/h1-3H |
| InChIKey | RLRUKKDFNWXXRT-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,5-difluorobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluorobenzoyl chloride?
The IUPAC name of 2,5-difluorobenzoyl chloride (CID 588082) is 2,5-difluorobenzoyl chloride.
What is the SMILES notation for 2,5-difluorobenzoyl chloride?
The canonical SMILES for 2,5-difluorobenzoyl chloride is O=C(Cl)c1cc(F)ccc1F.
What is the InChIKey of 2,5-difluorobenzoyl chloride?
The InChIKey is RLRUKKDFNWXXRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClF2O/c8-7(11)5-3-4(9)1-2-6(5)10/h1-3H.
What are the key properties of 2,5-difluorobenzoyl chloride?
2,5-difluorobenzoyl chloride has a molecular weight of 176.55 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluorobenzoyl chloride is sourced from PubChem (CID 588082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).