C25H30N4O4S — CID 58808296
N-[(1S,2R)-2-[2-(benzenesulfonamido)ethylcarbamoyl]cyclohexyl]-1-methylindole-2-carboxamide (PubChem CID 58808296) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is N-[(1S,2R)-2-[2-(benzenesulfonamido)ethylcarbamoyl]cyclohexyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[(1S,2R)-2-[2-(benzenesulfonamido)ethylcarbamoyl]cyclohexyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 58808296 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | N-[(1S,2R)-2-[2-(benzenesulfonamido)ethylcarbamoyl]cyclohexyl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)N[C@H]2CCCC[C@H]2C(=O)NCCNS(=O)(=O)c2ccccc2)cc2ccccc21 |
| InChI | InChI=1S/C25H30N4O4S/c1-29-22-14-8-5-9-18(22)17-23(29)25(31)28-21-13-7-6-12-20(21)24(30)26-15-16-27-34(32,33)19-10-3-2-4-11-19/h2-5,8-11,14,17,20-21,27H,6-7,12-13,15-16H2,1H3,(H,26,30)(H,28,31)/t20-,21+/m1/s1 |
| InChIKey | IJWKECKKKVFYTJ-RTWAWAEBSA-N |
| XLogP | 2.56 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|