C19H25N3O3 — CID 58808394
N-[(1S,2R)-2-(2-hydroxyethylcarbamoyl)cyclohexyl]-1-methylindole-2-carboxamide (PubChem CID 58808394) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[(1S,2R)-2-(2-hydroxyethylcarbamoyl)cyclohexyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[(1S,2R)-2-(2-hydroxyethylcarbamoyl)cyclohexyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 58808394 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-[(1S,2R)-2-(2-hydroxyethylcarbamoyl)cyclohexyl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)N[C@H]2CCCC[C@H]2C(=O)NCCO)cc2ccccc21 |
| InChI | InChI=1S/C19H25N3O3/c1-22-16-9-5-2-6-13(16)12-17(22)19(25)21-15-8-4-3-7-14(15)18(24)20-10-11-23/h2,5-6,9,12,14-15,23H,3-4,7-8,10-11H2,1H3,(H,20,24)(H,21,25)/t14-,15+/m1/s1 |
| InChIKey | NTSHWZPXFKPOPN-CABCVRRESA-N |
| XLogP | 1.58 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |