C31H35F6N7O3 — CID 58808426
ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(5-morpholin-4-ylpyrimidin-2-yl)amino]-2-ethyl-6-(methylamino)-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 58808426) has the molecular formula C31H35F6N7O3 and a molecular weight of 667.60 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(5-morpholin-4-ylpyrimidin-2-yl)amino]-2-ethyl-6-(methylamino)-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(5-morpholin-4-ylpyrimidin-2-yl)amino]-2-ethyl-6-(methylamino)-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 58808426 |
| Molecular Formula | C31H35F6N7O3 |
| Molecular Weight | 667.60 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | ethyl (2R,4S)-4-[[3,5-bis(trifluoromethyl)phenyl]methyl-(5-morpholin-4-ylpyrimidin-2-yl)amino]-2-ethyl-6-(methylamino)-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CC[C@@H]1C[C@@H](C2=C(N1C(=O)OCC)C=CC(=N2)NC)N(CC3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)C4=NC=C(C=N4)N5CCOCC5 |
| InChI | InChI=1S/C31H35F6N7O3/c1-4-22-15-25(27-24(6-7-26(38-3)41-27)44(22)29(45)47-5-2)43(28-39-16-23(17-40-28)42-8-10-46-11-9-42)18-19-12-20(30(32,33)34)14-21(13-19)31(35,36)37/h6-7,12-14,16-17,22,25H,4-5,8-11,15,18H2,1-3H3,(H,38,41)/t22-,25+/m1/s1 |
| InChIKey | ZQDRUJYHGCLPBE-RDGATRHJSA-N |
| XLogP | 5.70 |
| TPSA | 96.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | 989 |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |