C20H28N6O2 — CID 58808976
(2S)-2-[[2-[(4-acetylpiperazin-1-yl)methyl]quinazolin-4-yl]amino]-3-methylbutanamide (PubChem CID 58808976) has the molecular formula C20H28N6O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (2S)-2-[[2-[(4-acetylpiperazin-1-yl)methyl]quinazolin-4-yl]amino]-3-methylbutanamide.
| Compound Name | (2S)-2-[[2-[(4-acetylpiperazin-1-yl)methyl]quinazolin-4-yl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 58808976 |
| Molecular Formula | C20H28N6O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (2S)-2-[[2-[(4-acetylpiperazin-1-yl)methyl]quinazolin-4-yl]amino]-3-methylbutanamide |
| SMILES | CC(=O)N1CCN(Cc2nc(N[C@H](C(N)=O)C(C)C)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C20H28N6O2/c1-13(2)18(19(21)28)24-20-15-6-4-5-7-16(15)22-17(23-20)12-25-8-10-26(11-9-25)14(3)27/h4-7,13,18H,8-12H2,1-3H3,(H2,21,28)(H,22,23,24)/t18-/m0/s1 |
| InChIKey | BYTNDXTYWUPHJI-SFHVURJKSA-N |
| XLogP | 1.22 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |