C22H36N6 — CID 58808982
N',N'-dimethyl-N-[2-[[2-(2-methylpropyl)piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine (PubChem CID 58808982) has the molecular formula C22H36N6 and a molecular weight of 384.57 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[[2-(2-methylpropyl)piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[2-[[2-(2-methylpropyl)piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 58808982 |
| Molecular Formula | C22H36N6 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | N',N'-dimethyl-N-[2-[[2-(2-methylpropyl)piperazin-1-yl]methyl]quinazolin-4-yl]propane-1,3-diamine |
| SMILES | CC(C)CC1CNCCN1Cc1nc(NCCCN(C)C)c2ccccc2n1 |
| InChI | InChI=1S/C22H36N6/c1-17(2)14-18-15-23-11-13-28(18)16-21-25-20-9-6-5-8-19(20)22(26-21)24-10-7-12-27(3)4/h5-6,8-9,17-18,23H,7,10-16H2,1-4H3,(H,24,25,26) |
| InChIKey | ULGQVJLWUHCPEO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|