C20H16F3N3O2 — CID 58810010
6,9-difluoro-5-(2-fluorophenyl)-8-(2-methoxyethoxy)-1-methyl-2H-pyrazolo[3,4-c]isoquinoline (PubChem CID 58810010) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is 6,9-difluoro-5-(2-fluorophenyl)-8-(2-methoxyethoxy)-1-methyl-2H-pyrazolo[3,4-c]isoquinoline.
| Compound Name | 6,9-difluoro-5-(2-fluorophenyl)-8-(2-methoxyethoxy)-1-methyl-2H-pyrazolo[3,4-c]isoquinoline |
|---|---|
| PubChem CID | 58810010 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 6,9-difluoro-5-(2-fluorophenyl)-8-(2-methoxyethoxy)-1-methyl-2H-pyrazolo[3,4-c]isoquinoline |
| SMILES | COCCOc1cc(F)c2c(-c3ccccc3F)nc3n[nH]c(C)c3c2c1F |
| InChI | InChI=1S/C20H16F3N3O2/c1-10-15-17-16(13(22)9-14(18(17)23)28-8-7-27-2)19(24-20(15)26-25-10)11-5-3-4-6-12(11)21/h3-6,9H,7-8H2,1-2H3,(H,24,25,26) |
| InChIKey | UXVCZZBUNJSNNC-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|