C21H40O5Si — CID 58810576
(3S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4,6,6,8-pentamethyl-5-oxodec-9-enoic acid (PubChem CID 58810576) has the molecular formula C21H40O5Si and a molecular weight of 400.63 g/mol. Its IUPAC name is (3S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4,6,6,8-pentamethyl-5-oxodec-9-enoic acid.
| Compound Name | (3S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4,6,6,8-pentamethyl-5-oxodec-9-enoic acid |
|---|---|
| PubChem CID | 58810576 |
| Molecular Formula | C21H40O5Si |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (3S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4,6,6,8-pentamethyl-5-oxodec-9-enoic acid |
| SMILES | C=C[C@H](C)C(O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)C(C)(C)[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C21H40O5Si/c1-12-14(2)17(26-27(10,11)19(3,4)5)21(8,9)18(25)20(6,7)15(22)13-16(23)24/h12,14-15,17,22H,1,13H2,2-11H3,(H,23,24)/t14-,15-,17?/m0/s1 |
| InChIKey | ZJVQUAAAGKHAOO-GIIGEWEBSA-N |
| XLogP | 4.66 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|