C22H42O4Si — CID 58810577
(3S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,6,8-hexamethyl-5-oxodec-9-enoic acid (PubChem CID 58810577) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is (3S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,6,8-hexamethyl-5-oxodec-9-enoic acid.
| Compound Name | (3S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,6,8-hexamethyl-5-oxodec-9-enoic acid |
|---|---|
| PubChem CID | 58810577 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (3S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,4,6,6,8-hexamethyl-5-oxodec-9-enoic acid |
| SMILES | C=C[C@H](C)C(O[Si](C)(C)C(C)(C)C)C(C)(C)C(=O)C(C)(C)[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C22H42O4Si/c1-13-15(2)18(26-27(11,12)20(4,5)6)22(9,10)19(25)21(7,8)16(3)14-17(23)24/h13,15-16,18H,1,14H2,2-12H3,(H,23,24)/t15-,16-,18?/m0/s1 |
| InChIKey | BDSMIBPNMCPDAX-MZQXSQAVSA-N |
| XLogP | 5.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|