C40H84O5Si2 — CID 58810821
2,4-didecyl-2,4-dimethoxy-6,6,7,8,9,10,11,12-octamethyl-12-propan-2-yl-1,3,5-trioxa-2,4-disilacyclododecane (PubChem CID 58810821) has the molecular formula C40H84O5Si2 and a molecular weight of 701.28 g/mol. Its IUPAC name is 2,4-didecyl-2,4-dimethoxy-6,6,7,8,9,10,11,12-octamethyl-12-propan-2-yl-1,3,5-trioxa-2,4-disilacyclododecane.
| Compound Name | 2,4-didecyl-2,4-dimethoxy-6,6,7,8,9,10,11,12-octamethyl-12-propan-2-yl-1,3,5-trioxa-2,4-disilacyclododecane |
|---|---|
| PubChem CID | 58810821 |
| Molecular Formula | C40H84O5Si2 |
| Molecular Weight | 701.28 g/mol |
| Exact Mass | 700.59 |
| IUPAC Name | 2,4-didecyl-2,4-dimethoxy-6,6,7,8,9,10,11,12-octamethyl-12-propan-2-yl-1,3,5-trioxa-2,4-disilacyclododecane |
| SMILES | CCCCCCCCCC[Si]1(OC)OC(C)(C)C(C)C(C)C(C)C(C)C(C)C(C)(C(C)C)O[Si](CCCCCCCCCC)(OC)O1 |
| InChI | InChI=1S/C40H84O5Si2/c1-15-17-19-21-23-25-27-29-31-46(41-13)43-39(10,11)37(8)35(6)34(5)36(7)38(9)40(12,33(3)4)44-47(42-14,45-46)32-30-28-26-24-22-20-18-16-2/h33-38H,15-32H2,1-14H3 |
| InChIKey | JVEWELVNHFVRQY-UHFFFAOYSA-N |
| XLogP | 12.88 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.28 |
| LogP ≤ 5 | 12.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|