C10H24O4Si2 — CID 58811111
1,1,3,3-tetraethoxy-1,3-disiletane (PubChem CID 58811111) has the molecular formula C10H24O4Si2 and a molecular weight of 264.47 g/mol. Its IUPAC name is 1,1,3,3-tetraethoxy-1,3-disiletane.
| Compound Name | 1,1,3,3-tetraethoxy-1,3-disiletane |
|---|---|
| PubChem CID | 58811111 |
| Molecular Formula | C10H24O4Si2 |
| Molecular Weight | 264.47 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1,1,3,3-tetraethoxy-1,3-disiletane |
| SMILES | CCO[Si]1(OCC)C[Si](OCC)(OCC)C1 |
| InChI | InChI=1S/C10H24O4Si2/c1-5-11-15(12-6-2)9-16(10-15,13-7-3)14-8-4/h5-10H2,1-4H3 |
| InChIKey | WVUBQGDTOLPXBV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|