C24H48O10Si4 — CID 58811157
2-methyl-2-[4-[2-methyl-1-oxo-1-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl]-2,5-dioxooxolan-3-yl]propanoic acid (PubChem CID 58811157) has the molecular formula C24H48O10Si4 and a molecular weight of 608.98 g/mol. Its IUPAC name is 2-methyl-2-[4-[2-methyl-1-oxo-1-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl]-2,5-dioxooxolan-3-yl]propanoic acid.
| Compound Name | 2-methyl-2-[4-[2-methyl-1-oxo-1-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl]-2,5-dioxooxolan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 58811157 |
| Molecular Formula | C24H48O10Si4 |
| Molecular Weight | 608.98 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | 2-methyl-2-[4-[2-methyl-1-oxo-1-[3-tris(trimethylsilyloxy)silylpropoxy]propan-2-yl]-2,5-dioxooxolan-3-yl]propanoic acid |
| SMILES | CC(C)(C(=O)O)C1C(=O)OC(=O)C1C(C)(C)C(=O)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H48O10Si4/c1-23(2,21(27)28)17-18(20(26)31-19(17)25)24(3,4)22(29)30-15-14-16-38(32-35(5,6)7,33-36(8,9)10)34-37(11,12)13/h17-18H,14-16H2,1-13H3,(H,27,28) |
| InChIKey | WQXWTODKWKYOTD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.98 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|