C17H29NO2 — CID 58811364
(7E,9S,10S,11R,12Z)-9-methoxy-10,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one (PubChem CID 58811364) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is (7E,9S,10S,11R,12Z)-9-methoxy-10,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one.
| Compound Name | (7E,9S,10S,11R,12Z)-9-methoxy-10,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one |
|---|---|
| PubChem CID | 58811364 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | (7E,9S,10S,11R,12Z)-9-methoxy-10,11,13-trimethyl-1-azacyclotetradeca-7,12-dien-2-one |
| SMILES | CO[C@H]1/C=C/CCCCC(=O)NC/C(C)=C\[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C17H29NO2/c1-13-11-14(2)15(3)16(20-4)9-7-5-6-8-10-17(19)18-12-13/h7,9,11,14-16H,5-6,8,10,12H2,1-4H3,(H,18,19)/b9-7+,13-11-/t14-,15+,16+/m1/s1 |
| InChIKey | GKHYERVIKACFRX-BXRWGAHISA-N |
| XLogP | 3.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|