C20H40O3Si — CID 58811370
(3R,4Z,6R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyldeca-4,9-dien-3-ol (PubChem CID 58811370) has the molecular formula C20H40O3Si and a molecular weight of 356.62 g/mol. Its IUPAC name is (3R,4Z,6R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyldeca-4,9-dien-3-ol.
| Compound Name | (3R,4Z,6R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyldeca-4,9-dien-3-ol |
|---|---|
| PubChem CID | 58811370 |
| Molecular Formula | C20H40O3Si |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | (3R,4Z,6R,7S,8R)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyldeca-4,9-dien-3-ol |
| SMILES | C=C[C@@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(/C)[C@H](O)C(C)C |
| InChI | InChI=1S/C20H40O3Si/c1-12-17(22-9)19(23-24(10,11)20(6,7)8)16(5)13-15(4)18(21)14(2)3/h12-14,16-19,21H,1H2,2-11H3/b15-13-/t16-,17-,18-,19+/m1/s1 |
| InChIKey | TWAUPZNTBZVETB-KWPCDGKJSA-N |
| XLogP | 5.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|