C22H40O4Si — CID 58811382
(7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-7,12-dien-2-one (PubChem CID 58811382) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-7,12-dien-2-one.
| Compound Name | (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-7,12-dien-2-one |
|---|---|
| PubChem CID | 58811382 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (7E,9S,10S,11R,12Z)-10-[tert-butyl(dimethyl)silyl]oxy-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-7,12-dien-2-one |
| SMILES | CO[C@H]1/C=C/CCCCC(=O)OC/C(C)=C\[C@@H](C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O4Si/c1-17-15-18(2)21(26-27(7,8)22(3,4)5)19(24-6)13-11-9-10-12-14-20(23)25-16-17/h11,13,15,18-19,21H,9-10,12,14,16H2,1-8H3/b13-11+,17-15-/t18-,19+,21+/m1/s1 |
| InChIKey | IULIBKCBOQTPIF-PAOAYMACSA-N |
| XLogP | 5.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|