C28H43FO4 — CID 58811405
(3E,7E,9S,10S,11R,12Z)-14-[(2S)-6-cyclohexyl-3-oxohexan-2-yl]-10-fluoro-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one (PubChem CID 58811405) has the molecular formula C28H43FO4 and a molecular weight of 462.65 g/mol. Its IUPAC name is (3E,7E,9S,10S,11R,12Z)-14-[(2S)-6-cyclohexyl-3-oxohexan-2-yl]-10-fluoro-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one.
| Compound Name | (3E,7E,9S,10S,11R,12Z)-14-[(2S)-6-cyclohexyl-3-oxohexan-2-yl]-10-fluoro-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one |
|---|---|
| PubChem CID | 58811405 |
| Molecular Formula | C28H43FO4 |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | (3E,7E,9S,10S,11R,12Z)-14-[(2S)-6-cyclohexyl-3-oxohexan-2-yl]-10-fluoro-9-methoxy-11,13-dimethyl-1-oxacyclotetradeca-3,7,12-trien-2-one |
| SMILES | CO[C@H]1/C=C/CC/C=C/C(=O)OC([C@H](C)C(=O)CCCC2CCCCC2)/C(C)=C\[C@@H](C)[C@@H]1F |
| InChI | InChI=1S/C28H43FO4/c1-20-19-21(2)28(22(3)24(30)16-12-15-23-13-8-7-9-14-23)33-26(31)18-11-6-5-10-17-25(32-4)27(20)29/h10-11,17-20,22-23,25,27-28H,5-9,12-16H2,1-4H3/b17-10+,18-11+,21-19-/t20-,22-,25+,27+,28?/m1/s1 |
| InChIKey | XBLVALRJADHSAE-KTBWHNCMSA-N |
| XLogP | 6.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|