C20H22N2O3 — CID 58811758
6-acetyl-13,13,15-trimethyl-9,15-diazatetracyclo[8.7.0.02,8.012,16]heptadeca-1(17),2(8),10,12(16)-tetraene-7,14-dione (PubChem CID 58811758) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 6-acetyl-13,13,15-trimethyl-9,15-diazatetracyclo[8.7.0.02,8.012,16]heptadeca-1(17),2(8),10,12(16)-tetraene-7,14-dione.
| Compound Name | 6-acetyl-13,13,15-trimethyl-9,15-diazatetracyclo[8.7.0.02,8.012,16]heptadeca-1(17),2(8),10,12(16)-tetraene-7,14-dione |
|---|---|
| PubChem CID | 58811758 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 6-acetyl-13,13,15-trimethyl-9,15-diazatetracyclo[8.7.0.02,8.012,16]heptadeca-1(17),2(8),10,12(16)-tetraene-7,14-dione |
| SMILES | CC(=O)C1CCCc2c([nH]c3cc4c(cc23)N(C)C(=O)C4(C)C)C1=O |
| InChI | InChI=1S/C20H22N2O3/c1-10(23)11-6-5-7-12-13-8-16-14(20(2,3)19(25)22(16)4)9-15(13)21-17(12)18(11)24/h8-9,11,21H,5-7H2,1-4H3 |
| InChIKey | XBTYBMJQNATBOK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|