C18H18F2N2O2 — CID 58811798
13,13-difluoro-15-propan-2-yl-9,15-diazatetracyclo[8.7.0.02,8.012,16]heptadeca-1(17),2(8),10,12(16)-tetraene-7,14-dione (PubChem CID 58811798) has the molecular formula C18H18F2N2O2 and a molecular weight of 332.35 g/mol. Its IUPAC name is 13,13-difluoro-15-propan-2-yl-9,15-diazatetracyclo[8.7.0.02,8.012,16]heptadeca-1(17),2(8),10,12(16)-tetraene-7,14-dione.
| Compound Name | 13,13-difluoro-15-propan-2-yl-9,15-diazatetracyclo[8.7.0.02,8.012,16]heptadeca-1(17),2(8),10,12(16)-tetraene-7,14-dione |
|---|---|
| PubChem CID | 58811798 |
| Molecular Formula | C18H18F2N2O2 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 13,13-difluoro-15-propan-2-yl-9,15-diazatetracyclo[8.7.0.02,8.012,16]heptadeca-1(17),2(8),10,12(16)-tetraene-7,14-dione |
| SMILES | CC(C)N1C(=O)C(F)(F)c2cc3[nH]c4c(c3cc21)CCCCC4=O |
| InChI | InChI=1S/C18H18F2N2O2/c1-9(2)22-14-7-11-10-5-3-4-6-15(23)16(10)21-13(11)8-12(14)18(19,20)17(22)24/h7-9,21H,3-6H2,1-2H3 |
| InChIKey | FMUUYPZBFNCHPC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|