About 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one
5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one (PubChem CID 58811953) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one.
Molecular Properties
| Compound Name | 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one |
| PubChem CID | 58811953 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)C(C)(C)c2cc(N)ccc21 |
| InChI | InChI=1S/C13H16N2O/c1-4-7-15-11-6-5-9(14)8-10(11)13(2,3)12(15)16/h4-6,8H,1,7,14H2,2-3H3 |
| InChIKey | UVRDVRWJSOBFAJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one?
The IUPAC name of 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one (CID 58811953) is 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one.
What is the SMILES notation for 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one?
The canonical SMILES for 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one is C=CCN1C(=O)C(C)(C)c2cc(N)ccc21.
What is the InChIKey of 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one?
The InChIKey is UVRDVRWJSOBFAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-4-7-15-11-6-5-9(14)8-10(11)13(2,3)12(15)16/h4-6,8H,1,7,14H2,2-3H3.
What are the key properties of 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one?
5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one has a molecular weight of 216.28 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-3,3-dimethyl-1-prop-2-enylindol-2-one is sourced from PubChem (CID 58811953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).