About 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one
1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one (PubChem CID 58812021) has the molecular formula C15H18N2O3
and a molecular weight of 274.32 g/mol. Its IUPAC name is 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one |
| PubChem CID | 58812021 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one |
| SMILES | CCN1C(=O)C2(CCCCC2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C15H18N2O3/c1-2-16-13-7-6-11(17(19)20)10-12(13)15(14(16)18)8-4-3-5-9-15/h6-7,10H,2-5,8-9H2,1H3 |
| InChIKey | OUOVZCDRXSXXBE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one?
The IUPAC name of 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one (CID 58812021) is 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one.
What is the SMILES notation for 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one?
The canonical SMILES for 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one is CCN1C(=O)C2(CCCCC2)c2cc([N+](=O)[O-])ccc21.
What is the InChIKey of 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one?
The InChIKey is OUOVZCDRXSXXBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O3/c1-2-16-13-7-6-11(17(19)20)10-12(13)15(14(16)18)8-4-3-5-9-15/h6-7,10H,2-5,8-9H2,1H3.
What are the key properties of 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one?
1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one has a molecular weight of 274.32 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-ethyl-5'-nitrospiro[cyclohexane-1,3'-indole]-2'-one is sourced from PubChem (CID 58812021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).