C9H12N6O2 — CID 58812241
(6R)-6-(2-methyltetrazol-5-yl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 58812241) has the molecular formula C9H12N6O2 and a molecular weight of 236.23 g/mol. Its IUPAC name is (6R)-6-(2-methyltetrazol-5-yl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (6R)-6-(2-methyltetrazol-5-yl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 58812241 |
| Molecular Formula | C9H12N6O2 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (6R)-6-(2-methyltetrazol-5-yl)-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | Cn1nnc([C@H]2CCC3C(=O)NCC(=O)N32)n1 |
| InChI | InChI=1S/C9H12N6O2/c1-14-12-8(11-13-14)5-2-3-6-9(17)10-4-7(16)15(5)6/h5-6H,2-4H2,1H3,(H,10,17)/t5-,6?/m1/s1 |
| InChIKey | GQSQHOKKEZFYKB-LWOQYNTDSA-N |
| XLogP | -1.63 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |