C13H17N5O — CID 58812242
3-[(6R,8aS)-6-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile (PubChem CID 58812242) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-[(6R,8aS)-6-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile.
| Compound Name | 3-[(6R,8aS)-6-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 58812242 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 3-[(6R,8aS)-6-(hydroxymethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1N1CCN2[C@@H](CO)CC[C@H]2C1 |
| InChI | InChI=1S/C13H17N5O/c14-7-12-13(16-4-3-15-12)17-5-6-18-10(8-17)1-2-11(18)9-19/h3-4,10-11,19H,1-2,5-6,8-9H2/t10-,11+/m0/s1 |
| InChIKey | ZZVBCAAUIXCWAS-WDEREUQCSA-N |
| XLogP | -0.01 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |