C21H19ClN6O — CID 58812259
3-[(6R,8aS)-2-(3-isocyanopyrazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]-5-(2-chlorophenyl)-1,2-oxazole (PubChem CID 58812259) has the molecular formula C21H19ClN6O and a molecular weight of 406.88 g/mol. Its IUPAC name is 3-[(6R,8aS)-2-(3-isocyanopyrazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]-5-(2-chlorophenyl)-1,2-oxazole.
| Compound Name | 3-[(6R,8aS)-2-(3-isocyanopyrazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]-5-(2-chlorophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 58812259 |
| Molecular Formula | C21H19ClN6O |
| Molecular Weight | 406.88 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 3-[(6R,8aS)-2-(3-isocyanopyrazin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-6-yl]-5-(2-chlorophenyl)-1,2-oxazole |
| SMILES | [C-]#[N+]c1nccnc1N1CCN2[C@@H](CC[C@@H]2c2cc(-c3ccccc3Cl)on2)C1 |
| InChI | InChI=1S/C21H19ClN6O/c1-23-20-21(25-9-8-24-20)27-10-11-28-14(13-27)6-7-18(28)17-12-19(29-26-17)15-4-2-3-5-16(15)22/h2-5,8-9,12,14,18H,6-7,10-11,13H2/t14-,18+/m0/s1 |
| InChIKey | JQKNFBIMBGXVKN-KBXCAEBGSA-N |
| XLogP | 4.36 |
| TPSA | 62.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.88 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|