C10H14N2O — CID 58812302
(6R,8aS)-6-ethynyl-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one (PubChem CID 58812302) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is (6R,8aS)-6-ethynyl-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one.
| Compound Name | (6R,8aS)-6-ethynyl-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one |
|---|---|
| PubChem CID | 58812302 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (6R,8aS)-6-ethynyl-2-methyl-3,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-1-one |
| SMILES | C#C[C@H]1CC[C@H]2C(=O)N(C)CCN12 |
| InChI | InChI=1S/C10H14N2O/c1-3-8-4-5-9-10(13)11(2)6-7-12(8)9/h1,8-9H,4-7H2,2H3/t8-,9-/m0/s1 |
| InChIKey | HARWFNAATSEVHH-IUCAKERBSA-N |
| XLogP | -0.08 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|