C10H14N2O3 — CID 58812320
(6R,9aS)-6-acetyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 58812320) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is (6R,9aS)-6-acetyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | (6R,9aS)-6-acetyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 58812320 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (6R,9aS)-6-acetyl-3,6,7,8,9,9a-hexahydro-2H-pyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | CC(=O)[C@H]1CCC[C@H]2C(=O)NCC(=O)N12 |
| InChI | InChI=1S/C10H14N2O3/c1-6(13)7-3-2-4-8-10(15)11-5-9(14)12(7)8/h7-8H,2-5H2,1H3,(H,11,15)/t7-,8+/m1/s1 |
| InChIKey | BKXQROGCXREPER-SFYZADRCSA-N |
| XLogP | -0.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |