C34H40ClN5O5 — CID 58812655
N-[(2S)-1-(4-chlorophenyl)-4-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]butan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide (PubChem CID 58812655) has the molecular formula C34H40ClN5O5 and a molecular weight of 634.18 g/mol. Its IUPAC name is N-[(2S)-1-(4-chlorophenyl)-4-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]butan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide.
| Compound Name | N-[(2S)-1-(4-chlorophenyl)-4-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]butan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 58812655 |
| Molecular Formula | C34H40ClN5O5 |
| Molecular Weight | 634.18 g/mol |
| Exact Mass | 633.27 |
| IUPAC Name | N-[(2S)-1-(4-chlorophenyl)-4-[4-cyclohexyl-4-(1,2,4-triazol-1-ylmethyl)piperidin-1-yl]butan-2-yl]-6,7-dihydroxy-4-oxochromene-2-carboxamide |
| SMILES | O=C(N[C@H](CCN1CCC(Cn2cncn2)(C2CCCCC2)CC1)Cc1ccc(Cl)cc1)c1cc(=O)c2cc(O)c(O)cc2o1 |
| InChI | InChI=1S/C34H40ClN5O5/c35-25-8-6-23(7-9-25)16-26(38-33(44)32-18-28(41)27-17-29(42)30(43)19-31(27)45-32)10-13-39-14-11-34(12-15-39,20-40-22-36-21-37-40)24-4-2-1-3-5-24/h6-9,17-19,21-22,24,26,42-43H,1-5,10-16,20H2,(H,38,44)/t26-/m1/s1 |
| InChIKey | UTNFEDBQMOJXDE-AREMUKBSSA-N |
| XLogP | 5.54 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.18 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|