C19H24BrN6O2+ — CID 58812669
[1-[3-bromo-7-[(1-methoxypyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-2-yl]methanol (PubChem CID 58812669) has the molecular formula C19H24BrN6O2+ and a molecular weight of 448.35 g/mol. Its IUPAC name is [1-[3-bromo-7-[(1-methoxypyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-2-yl]methanol.
| Compound Name | [1-[3-bromo-7-[(1-methoxypyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 58812669 |
| Molecular Formula | C19H24BrN6O2+ |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | [1-[3-bromo-7-[(1-methoxypyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]piperidin-2-yl]methanol |
| SMILES | CO[n+]1cccc(CNc2cc(N3CCCCC3CO)nc3c(Br)cnn23)c1 |
| InChI | InChI=1S/C19H24BrN6O2/c1-28-24-7-4-5-14(12-24)10-21-17-9-18(23-19-16(20)11-22-26(17)19)25-8-3-2-6-15(25)13-27/h4-5,7,9,11-12,15,21,27H,2-3,6,8,10,13H2,1H3/q+1 |
| InChIKey | KMYDTDIGNCGCRR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|