C18H24BrN6O2+ — CID 58812673
(2R)-2-[[3-bromo-7-[(1-methoxypyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]pentan-1-ol (PubChem CID 58812673) has the molecular formula C18H24BrN6O2+ and a molecular weight of 436.33 g/mol. Its IUPAC name is (2R)-2-[[3-bromo-7-[(1-methoxypyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]pentan-1-ol.
| Compound Name | (2R)-2-[[3-bromo-7-[(1-methoxypyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 58812673 |
| Molecular Formula | C18H24BrN6O2+ |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (2R)-2-[[3-bromo-7-[(1-methoxypyridin-1-ium-3-yl)methylamino]pyrazolo[1,5-a]pyrimidin-5-yl]amino]pentan-1-ol |
| SMILES | CCC[C@H](CO)Nc1cc(NCc2ccc[n+](OC)c2)n2ncc(Br)c2n1 |
| InChI | InChI=1S/C18H24BrN6O2/c1-3-5-14(12-26)22-16-8-17(25-18(23-16)15(19)10-21-25)20-9-13-6-4-7-24(11-13)27-2/h4,6-8,10-11,14,20,26H,3,5,9,12H2,1-2H3,(H,22,23)/q+1/t14-/m1/s1 |
| InChIKey | FKSUOTAVWUBJTQ-CQSZACIVSA-N |
| XLogP | 2.02 |
| TPSA | 87.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|