C14H12F11N3O3 — CID 58813220
2-(2,2,3,3,4,4,4-heptafluorobutoxy)-4-prop-2-enoxy-6-(2,2,3,3-tetrafluorobutoxy)-1,3,5-triazine (PubChem CID 58813220) has the molecular formula C14H12F11N3O3 and a molecular weight of 479.25 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,4-heptafluorobutoxy)-4-prop-2-enoxy-6-(2,2,3,3-tetrafluorobutoxy)-1,3,5-triazine.
| Compound Name | 2-(2,2,3,3,4,4,4-heptafluorobutoxy)-4-prop-2-enoxy-6-(2,2,3,3-tetrafluorobutoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 58813220 |
| Molecular Formula | C14H12F11N3O3 |
| Molecular Weight | 479.25 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 2-(2,2,3,3,4,4,4-heptafluorobutoxy)-4-prop-2-enoxy-6-(2,2,3,3-tetrafluorobutoxy)-1,3,5-triazine |
| SMILES | C=CCOc1nc(OCC(F)(F)C(C)(F)F)nc(OCC(F)(F)C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C14H12F11N3O3/c1-3-4-29-7-26-8(30-5-11(17,18)10(2,15)16)28-9(27-7)31-6-12(19,20)13(21,22)14(23,24)25/h3H,1,4-6H2,2H3 |
| InChIKey | ABVHBEHAOWFUST-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.25 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|