C14H21F7O — CID 58813222
1-ethyl-3-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propyl]cyclopentane (PubChem CID 58813222) has the molecular formula C14H21F7O and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propyl]cyclopentane.
| Compound Name | 1-ethyl-3-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propyl]cyclopentane |
|---|---|
| PubChem CID | 58813222 |
| Molecular Formula | C14H21F7O |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-ethyl-3-[3-(2,2,3,3,4,4,4-heptafluorobutoxy)propyl]cyclopentane |
| SMILES | CCC1CCC(CCCOCC(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C14H21F7O/c1-2-10-5-6-11(8-10)4-3-7-22-9-12(15,16)13(17,18)14(19,20)21/h10-11H,2-9H2,1H3 |
| InChIKey | MGEBWYCXXJLZNF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|