C20H35F5O — CID 58813226
4-ethyl-1-octyl-2-(3,3,4,4,4-pentafluorobutoxymethyl)cyclopentane (PubChem CID 58813226) has the molecular formula C20H35F5O and a molecular weight of 386.49 g/mol. Its IUPAC name is 4-ethyl-1-octyl-2-(3,3,4,4,4-pentafluorobutoxymethyl)cyclopentane.
| Compound Name | 4-ethyl-1-octyl-2-(3,3,4,4,4-pentafluorobutoxymethyl)cyclopentane |
|---|---|
| PubChem CID | 58813226 |
| Molecular Formula | C20H35F5O |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 4-ethyl-1-octyl-2-(3,3,4,4,4-pentafluorobutoxymethyl)cyclopentane |
| SMILES | CCCCCCCCC1CC(CC)CC1COCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H35F5O/c1-3-5-6-7-8-9-10-17-13-16(4-2)14-18(17)15-26-12-11-19(21,22)20(23,24)25/h16-18H,3-15H2,1-2H3 |
| InChIKey | OIOIXCINAOEYOW-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|