C14H11F5 — CID 58813245
5-[(2,3,4,5,6-pentafluorophenyl)methyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 58813245) has the molecular formula C14H11F5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 5-[(2,3,4,5,6-pentafluorophenyl)methyl]bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-[(2,3,4,5,6-pentafluorophenyl)methyl]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 58813245 |
| Molecular Formula | C14H11F5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 5-[(2,3,4,5,6-pentafluorophenyl)methyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | Fc1c(F)c(F)c(CC2CC3C=CC2C3)c(F)c1F |
| InChI | InChI=1S/C14H11F5/c15-10-9(11(16)13(18)14(19)12(10)17)5-8-4-6-1-2-7(8)3-6/h1-2,6-8H,3-5H2 |
| InChIKey | HCMKEKGUPMRUOO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|