About 3-ethyl-2-fluorooxane
3-ethyl-2-fluorooxane (PubChem CID 58813258) has the molecular formula C7H13FO
and a molecular weight of 132.18 g/mol. Its IUPAC name is 3-ethyl-2-fluorooxane.
Molecular Properties
| Compound Name | 3-ethyl-2-fluorooxane |
| PubChem CID | 58813258 |
| Molecular Formula | C7H13FO |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.10 |
| IUPAC Name | 3-ethyl-2-fluorooxane |
| SMILES | CCC1CCCOC1F |
| InChI | InChI=1S/C7H13FO/c1-2-6-4-3-5-9-7(6)8/h6-7H,2-5H2,1H3 |
| InChIKey | VQPAXNVTXAUAET-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-2-fluorooxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-fluorooxane?
The IUPAC name of 3-ethyl-2-fluorooxane (CID 58813258) is 3-ethyl-2-fluorooxane.
What is the SMILES notation for 3-ethyl-2-fluorooxane?
The canonical SMILES for 3-ethyl-2-fluorooxane is CCC1CCCOC1F.
What is the InChIKey of 3-ethyl-2-fluorooxane?
The InChIKey is VQPAXNVTXAUAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FO/c1-2-6-4-3-5-9-7(6)8/h6-7H,2-5H2,1H3.
What are the key properties of 3-ethyl-2-fluorooxane?
3-ethyl-2-fluorooxane has a molecular weight of 132.18 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-fluorooxane is sourced from PubChem (CID 58813258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).