About 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine
7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 58813306) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine |
| PubChem CID | 58813306 |
| Molecular Formula | C7H9N5 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Cn1ccc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C7H9N5/c1-12-3-2-4-5(8)10-7(9)11-6(4)12/h2-3H,1H3,(H4,8,9,10,11) |
| InChIKey | NDOUJZKOINDEKJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine?
The IUPAC name of 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine (CID 58813306) is 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine.
What is the SMILES notation for 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine?
The canonical SMILES for 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine is Cn1ccc2c(N)nc(N)nc21.
What is the InChIKey of 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine?
The InChIKey is NDOUJZKOINDEKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c1-12-3-2-4-5(8)10-7(9)11-6(4)12/h2-3H,1H3,(H4,8,9,10,11).
What are the key properties of 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine?
7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine has a molecular weight of 163.18 g/mol, XLogP of 0.13, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylpyrrolo[2,3-d]pyrimidine-2,4-diamine is sourced from PubChem (CID 58813306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).