C26H15NY-2 — CID 58813566
2-(2H-pentacen-2-id-1-yl)-1,3-dihydropyrrol-3-ide;yttrium (PubChem CID 58813566) has the molecular formula C26H15NY-2 and a molecular weight of 430.32 g/mol. Its IUPAC name is 2-(2H-pentacen-2-id-1-yl)-1,3-dihydropyrrol-3-ide;yttrium.
| Compound Name | 2-(2H-pentacen-2-id-1-yl)-1,3-dihydropyrrol-3-ide;yttrium |
|---|---|
| PubChem CID | 58813566 |
| Molecular Formula | C26H15NY-2 |
| Molecular Weight | 430.32 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 2-(2H-pentacen-2-id-1-yl)-1,3-dihydropyrrol-3-ide;yttrium |
| SMILES | [Y].[c-]1cc[nH]c1-c1[c-]ccc2cc3cc4cc5ccccc5cc4cc3cc12 |
| InChI | InChI=1S/C26H15N.Y/c1-2-6-18-12-21-15-23-16-25-19(7-3-8-24(25)26-9-4-10-27-26)13-22(23)14-20(21)11-17(18)5-1;/h1-7,10-16,27H;/q-2; |
| InChIKey | GWCZGSBCSRUCND-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.32 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|