About 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium
6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium (PubChem CID 58813795) has the molecular formula C24H12N4Y-2
and a molecular weight of 445.29 g/mol. Its IUPAC name is 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium.
Molecular Properties
| Compound Name | 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium |
| PubChem CID | 58813795 |
| Molecular Formula | C24H12N4Y-2 |
| Molecular Weight | 445.29 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium |
| SMILES | [Y].[c-]1c(-c2[c-]c3cccnc3c3ncccc23)c2cccnc2c2ncccc12 |
| InChI | InChI=1S/C24H12N4.Y/c1-5-15-13-19(17-7-3-11-27-23(17)21(15)25-9-1)20-14-16-6-2-10-26-22(16)24-18(20)8-4-12-28-24;/h1-12H;/q-2; |
| InChIKey | DBNCMHFZNOZNAU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.29 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium?
The IUPAC name of 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium (CID 58813795) is 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium.
What is the SMILES notation for 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium?
The canonical SMILES for 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium is [Y].[c-]1c(-c2[c-]c3cccnc3c3ncccc23)c2cccnc2c2ncccc12.
What is the InChIKey of 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium?
The InChIKey is DBNCMHFZNOZNAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H12N4.Y/c1-5-15-13-19(17-7-3-11-27-23(17)21(15)25-9-1)20-14-16-6-2-10-26-22(16)24-18(20)8-4-12-28-24;/h1-12H;/q-2;.
What are the key properties of 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium?
6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium has a molecular weight of 445.29 g/mol, XLogP of 5.14, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6H-1,10-phenanthrolin-6-id-5-yl)-5H-1,10-phenanthrolin-5-ide;yttrium is sourced from PubChem (CID 58813795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).