About 3,4,9-trimethylacridine
3,4,9-trimethylacridine (PubChem CID 58813802) has the molecular formula C16H15N
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3,4,9-trimethylacridine.
Molecular Properties
| Compound Name | 3,4,9-trimethylacridine |
| PubChem CID | 58813802 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3,4,9-trimethylacridine |
| SMILES | Cc1ccc2c(C)c3ccccc3nc2c1C |
| InChI | InChI=1S/C16H15N/c1-10-8-9-14-12(3)13-6-4-5-7-15(13)17-16(14)11(10)2/h4-9H,1-3H3 |
| InChIKey | NIHCDVNVSUYQAD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3,4,9-trimethylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,9-trimethylacridine?
The IUPAC name of 3,4,9-trimethylacridine (CID 58813802) is 3,4,9-trimethylacridine.
What is the SMILES notation for 3,4,9-trimethylacridine?
The canonical SMILES for 3,4,9-trimethylacridine is Cc1ccc2c(C)c3ccccc3nc2c1C.
What is the InChIKey of 3,4,9-trimethylacridine?
The InChIKey is NIHCDVNVSUYQAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N/c1-10-8-9-14-12(3)13-6-4-5-7-15(13)17-16(14)11(10)2/h4-9H,1-3H3.
What are the key properties of 3,4,9-trimethylacridine?
3,4,9-trimethylacridine has a molecular weight of 221.30 g/mol, XLogP of 4.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,9-trimethylacridine is sourced from PubChem (CID 58813802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).