About 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium
3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium (PubChem CID 58813956) has the molecular formula C6H5NY-2
and a molecular weight of 180.02 g/mol. Its IUPAC name is 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium.
Molecular Properties
| Compound Name | 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium |
| PubChem CID | 58813956 |
| Molecular Formula | C6H5NY-2 |
| Molecular Weight | 180.02 g/mol |
| Exact Mass | 179.95 |
| IUPAC Name | 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium |
| SMILES | [H]/[C-]=C/c1[c-][nH]cc1.[Y] |
| InChI | InChI=1S/C6H5N.Y/c1-2-6-3-4-7-5-6;/h1-4,7H;/q-2; |
| InChIKey | KGSSGYYGYXGVTA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.02 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium?
The IUPAC name of 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium (CID 58813956) is 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium.
What is the SMILES notation for 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium?
The canonical SMILES for 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium is [H]/[C-]=C/c1[c-][nH]cc1.[Y].
What is the InChIKey of 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium?
The InChIKey is KGSSGYYGYXGVTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N.Y/c1-2-6-3-4-7-5-6;/h1-4,7H;/q-2;.
What are the key properties of 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium?
3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium has a molecular weight of 180.02 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-1,2-dihydropyrrol-2-ide;yttrium is sourced from PubChem (CID 58813956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).