About 5,6,8-trimethylquinoxaline
5,6,8-trimethylquinoxaline (PubChem CID 58813986) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 5,6,8-trimethylquinoxaline.
Molecular Properties
| Compound Name | 5,6,8-trimethylquinoxaline |
| PubChem CID | 58813986 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 5,6,8-trimethylquinoxaline |
| SMILES | Cc1cc(C)c2nccnc2c1C |
| InChI | InChI=1S/C11H12N2/c1-7-6-8(2)10-11(9(7)3)13-5-4-12-10/h4-6H,1-3H3 |
| InChIKey | AFFAWZFDYNYCNG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6,8-trimethylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,8-trimethylquinoxaline?
The IUPAC name of 5,6,8-trimethylquinoxaline (CID 58813986) is 5,6,8-trimethylquinoxaline.
What is the SMILES notation for 5,6,8-trimethylquinoxaline?
The canonical SMILES for 5,6,8-trimethylquinoxaline is Cc1cc(C)c2nccnc2c1C.
What is the InChIKey of 5,6,8-trimethylquinoxaline?
The InChIKey is AFFAWZFDYNYCNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-7-6-8(2)10-11(9(7)3)13-5-4-12-10/h4-6H,1-3H3.
What are the key properties of 5,6,8-trimethylquinoxaline?
5,6,8-trimethylquinoxaline has a molecular weight of 172.23 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,8-trimethylquinoxaline is sourced from PubChem (CID 58813986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).