C13H13F3IrN3- — CID 58814009
4-tert-butyl-2-[3-(trifluoromethyl)-5H-pyrazol-5-id-1-yl]pyridine;iridium (PubChem CID 58814009) has the molecular formula C13H13F3IrN3- and a molecular weight of 460.48 g/mol. Its IUPAC name is 4-tert-butyl-2-[3-(trifluoromethyl)-5H-pyrazol-5-id-1-yl]pyridine;iridium.
| Compound Name | 4-tert-butyl-2-[3-(trifluoromethyl)-5H-pyrazol-5-id-1-yl]pyridine;iridium |
|---|---|
| PubChem CID | 58814009 |
| Molecular Formula | C13H13F3IrN3- |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 461.07 |
| IUPAC Name | 4-tert-butyl-2-[3-(trifluoromethyl)-5H-pyrazol-5-id-1-yl]pyridine;iridium |
| SMILES | CC(C)(C)c1ccnc(-n2[c-]cc(C(F)(F)F)n2)c1.[Ir] |
| InChI | InChI=1S/C13H13F3N3.Ir/c1-12(2,3)9-4-6-17-11(8-9)19-7-5-10(18-19)13(14,15)16;/h4-6,8H,1-3H3;/q-1; |
| InChIKey | GHACEUUJQGRCQD-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|