About 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium
2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium (PubChem CID 58814079) has the molecular formula C7H17MtNO8S3
and a molecular weight of 617.41 g/mol. Its IUPAC name is 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium.
Molecular Properties
| Compound Name | 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium |
| PubChem CID | 58814079 |
| Molecular Formula | C7H17MtNO8S3 |
| Molecular Weight | 617.41 g/mol |
| Exact Mass | 617.17 |
| IUPAC Name | 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium |
| SMILES | CS(=O)(=O)CCCS(=O)(=O)NCC(O)CS(=O)(=O)O.[Mt] |
| InChI | InChI=1S/C7H17NO8S3.Mt/c1-17(10,11)3-2-4-18(12,13)8-5-7(9)6-19(14,15)16;/h7-9H,2-6H2,1H3,(H,14,15,16); |
| InChIKey | PHHFEOCZHIDSCW-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 617.41 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium?
The IUPAC name of 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium (CID 58814079) is 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium.
What is the SMILES notation for 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium?
The canonical SMILES for 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium is CS(=O)(=O)CCCS(=O)(=O)NCC(O)CS(=O)(=O)O.[Mt].
What is the InChIKey of 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium?
The InChIKey is PHHFEOCZHIDSCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO8S3.Mt/c1-17(10,11)3-2-4-18(12,13)8-5-7(9)6-19(14,15)16;/h7-9H,2-6H2,1H3,(H,14,15,16);.
What are the key properties of 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium?
2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium has a molecular weight of 617.41 g/mol, XLogP of -2.41, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-(3-methylsulfonylpropylsulfonylamino)propane-1-sulfonic acid;meitnerium is sourced from PubChem (CID 58814079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).