About tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum
tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum (PubChem CID 58814296) has the molecular formula C14H29ClN3Ta-2
and a molecular weight of 455.81 g/mol. Its IUPAC name is tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum.
Molecular Properties
| Compound Name | tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum |
| PubChem CID | 58814296 |
| Molecular Formula | C14H29ClN3Ta-2 |
| Molecular Weight | 455.81 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum |
| SMILES | CC(C)(C)/N=[Ta]\Cl.CC(C)(C)[N-]/C=C\[N-]C(C)(C)C |
| InChI | InChI=1S/C10H20N2.C4H9N.ClH.Ta/c1-9(2,3)11-7-8-12-10(4,5)6;1-4(2,3)5;;/h7-8H,1-6H3;1-3H3;1H;/q-2;;;+1/p-1/b8-7-;;; |
| InChIKey | JTHSTBMTRABGLM-IRYVOTIRSA-M |
| XLogP | 6.01 |
| TPSA | 40.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.81 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum?
The IUPAC name of tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum (CID 58814296) is tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum.
What is the SMILES notation for tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum?
The canonical SMILES for tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum is CC(C)(C)/N=[Ta]\Cl.CC(C)(C)[N-]/C=C\[N-]C(C)(C)C.
What is the InChIKey of tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum?
The InChIKey is JTHSTBMTRABGLM-IRYVOTIRSA-M. The full InChI is InChI=1S/C10H20N2.C4H9N.ClH.Ta/c1-9(2,3)11-7-8-12-10(4,5)6;1-4(2,3)5;;/h7-8H,1-6H3;1-3H3;1H;/q-2;;;+1/p-1/b8-7-;;;.
What are the key properties of tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum?
tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum has a molecular weight of 455.81 g/mol, XLogP of 6.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(Z)-2-tert-butylazanidylethenyl]azanide;tert-butylimino(chloro)tantalum is sourced from PubChem (CID 58814296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).