C15H17N3O2 — CID 58814538
(5E)-5-[(2E,4E)-5-(dimethylamino)penta-2,4-dienylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 58814538) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is (5E)-5-[(2E,4E)-5-(dimethylamino)penta-2,4-dienylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[(2E,4E)-5-(dimethylamino)penta-2,4-dienylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 58814538 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (5E)-5-[(2E,4E)-5-(dimethylamino)penta-2,4-dienylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C)C(=O)/C1=C/C=C/C=C/N(C)C |
| InChI | InChI=1S/C15H17N3O2/c1-11-12(8-6-5-7-9-17(2)3)14(19)18(4)15(20)13(11)10-16/h5-9H,1-4H3/b6-5+,9-7+,12-8+ |
| InChIKey | YVNOVPNKYRXGRV-XYXUFPSCSA-N |
| XLogP | 1.38 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|