C36H45N4O13S2+ — CID 58814734
[9-[2-[[4-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-4-oxobutyl]-methylcarbamoyl]phenyl]-6-(ethylamino)-4,5-disulfoxanthen-3-ylidene]-ethylazanium (PubChem CID 58814734) has the molecular formula C36H45N4O13S2+ and a molecular weight of 805.90 g/mol. Its IUPAC name is [9-[2-[[4-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-4-oxobutyl]-methylcarbamoyl]phenyl]-6-(ethylamino)-4,5-disulfoxanthen-3-ylidene]-ethylazanium.
| Compound Name | [9-[2-[[4-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-4-oxobutyl]-methylcarbamoyl]phenyl]-6-(ethylamino)-4,5-disulfoxanthen-3-ylidene]-ethylazanium |
|---|---|
| PubChem CID | 58814734 |
| Molecular Formula | C36H45N4O13S2+ |
| Molecular Weight | 805.90 g/mol |
| Exact Mass | 805.24 |
| IUPAC Name | [9-[2-[[4-[2-[2-(2-carboxyethoxy)ethoxy]ethylamino]-4-oxobutyl]-methylcarbamoyl]phenyl]-6-(ethylamino)-4,5-disulfoxanthen-3-ylidene]-ethylazanium |
| SMILES | CCNc1ccc2c(-c3ccccc3C(=O)N(C)CCCC(=O)NCCOCCOCCC(=O)O)c3cc/c(=[NH+]\CC)c(S(=O)(=O)O)c-3oc2c1S(=O)(=O)O |
| InChI | InChI=1S/C36H44N4O13S2/c1-4-37-27-14-12-25-31(26-13-15-28(38-5-2)35(55(48,49)50)33(26)53-32(25)34(27)54(45,46)47)23-9-6-7-10-24(23)36(44)40(3)18-8-11-29(41)39-17-20-52-22-21-51-19-16-30(42)43/h6-7,9-10,12-15,37H,4-5,8,11,16-22H2,1-3H3,(H,39,41)(H,42,43)(H,45,46,47)(H,48,49,50)/p+1/b38-28+ |
| InChIKey | UFYHTBWQMFPEEL-HXPUERGNSA-O |
| XLogP | 1.61 |
| TPSA | 253.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.90 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|