About (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide
(2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide (PubChem CID 58814794) has the molecular formula C11H19N3O3S
and a molecular weight of 273.36 g/mol. Its IUPAC name is (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide.
Molecular Properties
| Compound Name | (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide |
| PubChem CID | 58814794 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide |
| SMILES | CCCN1C(=O)CC(SC[C@H](NC)C(N)=O)C1=O |
| InChI | InChI=1S/C11H19N3O3S/c1-3-4-14-9(15)5-8(11(14)17)18-6-7(13-2)10(12)16/h7-8,13H,3-6H2,1-2H3,(H2,12,16)/t7-,8?/m0/s1 |
| InChIKey | NYCLKPLQIMQYKN-JAMMHHFISA-N |
| XLogP | -0.67 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide?
The IUPAC name of (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide (CID 58814794) is (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide.
What is the SMILES notation for (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide?
The canonical SMILES for (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide is CCCN1C(=O)CC(SC[C@H](NC)C(N)=O)C1=O.
What is the InChIKey of (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide?
The InChIKey is NYCLKPLQIMQYKN-JAMMHHFISA-N. The full InChI is InChI=1S/C11H19N3O3S/c1-3-4-14-9(15)5-8(11(14)17)18-6-7(13-2)10(12)16/h7-8,13H,3-6H2,1-2H3,(H2,12,16)/t7-,8?/m0/s1.
What are the key properties of (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide?
(2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide has a molecular weight of 273.36 g/mol, XLogP of -0.67, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(2,5-dioxo-1-propylpyrrolidin-3-yl)sulfanyl-2-(methylamino)propanamide is sourced from PubChem (CID 58814794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).