About 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine
1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine (PubChem CID 58814886) has the molecular formula C10H19NO2S
and a molecular weight of 217.33 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine |
| PubChem CID | 58814886 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine |
| SMILES | NC1(C2CCCS2(=O)=O)CCCCC1 |
| InChI | InChI=1S/C10H19NO2S/c11-10(6-2-1-3-7-10)9-5-4-8-14(9,12)13/h9H,1-8,11H2 |
| InChIKey | RESKHPIWXVGNSY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine?
The IUPAC name of 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine (CID 58814886) is 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine.
What is the SMILES notation for 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine?
The canonical SMILES for 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine is NC1(C2CCCS2(=O)=O)CCCCC1.
What is the InChIKey of 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine?
The InChIKey is RESKHPIWXVGNSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2S/c11-10(6-2-1-3-7-10)9-5-4-8-14(9,12)13/h9H,1-8,11H2.
What are the key properties of 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine?
1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine has a molecular weight of 217.33 g/mol, XLogP of 1.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-2-yl)cyclohexan-1-amine is sourced from PubChem (CID 58814886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).