About 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione
4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione (PubChem CID 58815501) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione.
Molecular Properties
| Compound Name | 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione |
| PubChem CID | 58815501 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione |
| SMILES | CC(=O)Cc1cc(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C7H8N2O3/c1-4(10)2-5-3-6(11)8-9-7(5)12/h3H,2H2,1H3,(H,8,11)(H,9,12) |
| InChIKey | FKRUWWZWXPWBAP-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione?
The IUPAC name of 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione (CID 58815501) is 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione.
What is the SMILES notation for 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione?
The canonical SMILES for 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione is CC(=O)Cc1cc(=O)[nH][nH]c1=O.
What is the InChIKey of 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione?
The InChIKey is FKRUWWZWXPWBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c1-4(10)2-5-3-6(11)8-9-7(5)12/h3H,2H2,1H3,(H,8,11)(H,9,12).
What are the key properties of 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione?
4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione has a molecular weight of 168.15 g/mol, XLogP of -0.81, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-oxopropyl)-1,2-dihydropyridazine-3,6-dione is sourced from PubChem (CID 58815501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).