C24H31N3O3 — CID 58815680
methyl 8-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-azatricyclo[4.3.0.01,3]nonane-2-carboxylate (PubChem CID 58815680) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is methyl 8-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-azatricyclo[4.3.0.01,3]nonane-2-carboxylate.
| Compound Name | methyl 8-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-azatricyclo[4.3.0.01,3]nonane-2-carboxylate |
|---|---|
| PubChem CID | 58815680 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | methyl 8-(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)-2-azatricyclo[4.3.0.01,3]nonane-2-carboxylate |
| SMILES | COC(=O)N1C2CCC3CC(N4CCC5(CC4)CN(C(C)=O)c4ccccc45)CC321 |
| InChI | InChI=1S/C24H31N3O3/c1-16(28)26-15-23(19-5-3-4-6-20(19)26)9-11-25(12-10-23)18-13-17-7-8-21-24(17,14-18)27(21)22(29)30-2/h3-6,17-18,21H,7-15H2,1-2H3 |
| InChIKey | FKINJHCRPWMTHE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 52.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|